C11H12S — CID 91197191
3-methylidene-7-methylsulfanyl-1,2-dihydroindene (PubChem CID 91197191) has the molecular formula C11H12S and a molecular weight of 176.28 g/mol. Its IUPAC name is 3-methylidene-7-methylsulfanyl-1,2-dihydroindene.
| Compound Name | 3-methylidene-7-methylsulfanyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 91197191 |
| Molecular Formula | C11H12S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 3-methylidene-7-methylsulfanyl-1,2-dihydroindene |
| SMILES | C=C1CCc2c(SC)cccc21 |
| InChI | InChI=1S/C11H12S/c1-8-6-7-10-9(8)4-3-5-11(10)12-2/h3-5H,1,6-7H2,2H3 |
| InChIKey | SVIJBNQGPOVYQJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |