C9H9NOS — CID 154160776
5-amino-3,4-dihydrothiochromen-2-one (PubChem CID 154160776) has the molecular formula C9H9NOS and a molecular weight of 179.24 g/mol. Its IUPAC name is 5-amino-3,4-dihydrothiochromen-2-one.
| Compound Name | 5-amino-3,4-dihydrothiochromen-2-one |
|---|---|
| PubChem CID | 154160776 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 5-amino-3,4-dihydrothiochromen-2-one |
| SMILES | Nc1cccc2c1CCC(=O)S2 |
| InChI | InChI=1S/C9H9NOS/c10-7-2-1-3-8-6(7)4-5-9(11)12-8/h1-3H,4-5,10H2 |
| InChIKey | CFSZFUHSXIWKIN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|