C8H7NO2S — CID 115094769
5-hydroxy-3,4-dihydro-1,4-benzothiazin-2-one (PubChem CID 115094769) has the molecular formula C8H7NO2S and a molecular weight of 181.22 g/mol. Its IUPAC name is 5-hydroxy-3,4-dihydro-1,4-benzothiazin-2-one.
| Compound Name | 5-hydroxy-3,4-dihydro-1,4-benzothiazin-2-one |
|---|---|
| PubChem CID | 115094769 |
| Molecular Formula | C8H7NO2S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 5-hydroxy-3,4-dihydro-1,4-benzothiazin-2-one |
| SMILES | O=C1CNc2c(O)cccc2S1 |
| InChI | InChI=1S/C8H7NO2S/c10-5-2-1-3-6-8(5)9-4-7(11)12-6/h1-3,9-10H,4H2 |
| InChIKey | JKRFTKUWUBQWFE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|