C7H8N2OS — CID 143597083
2-amino-2,3-dihydro-1,3-benzothiazol-4-ol (PubChem CID 143597083) has the molecular formula C7H8N2OS and a molecular weight of 168.22 g/mol. Its IUPAC name is 2-amino-2,3-dihydro-1,3-benzothiazol-4-ol.
| Compound Name | 2-amino-2,3-dihydro-1,3-benzothiazol-4-ol |
|---|---|
| PubChem CID | 143597083 |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 2-amino-2,3-dihydro-1,3-benzothiazol-4-ol |
| SMILES | NC1Nc2c(O)cccc2S1 |
| InChI | InChI=1S/C7H8N2OS/c8-7-9-6-4(10)2-1-3-5(6)11-7/h1-3,7,9-10H,8H2 |
| InChIKey | HNNFNTVNDUJNCD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|