C11H13NOS — CID 115097342
spiro[3,4-dihydro-1,4-benzothiazine-2,1'-cyclobutane]-5-ol (PubChem CID 115097342) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is spiro[3,4-dihydro-1,4-benzothiazine-2,1'-cyclobutane]-5-ol.
| Compound Name | spiro[3,4-dihydro-1,4-benzothiazine-2,1'-cyclobutane]-5-ol |
|---|---|
| PubChem CID | 115097342 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | spiro[3,4-dihydro-1,4-benzothiazine-2,1'-cyclobutane]-5-ol |
| SMILES | Oc1cccc2c1NCC1(CCC1)S2 |
| InChI | InChI=1S/C11H13NOS/c13-8-3-1-4-9-10(8)12-7-11(14-9)5-2-6-11/h1,3-4,12-13H,2,5-7H2 |
| InChIKey | YGFRZFMYZKZECP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|