C12H16N2O — CID 115099268
spiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclobutane]-6-ol (PubChem CID 115099268) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is spiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclobutane]-6-ol.
| Compound Name | spiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclobutane]-6-ol |
|---|---|
| PubChem CID | 115099268 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | spiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclobutane]-6-ol |
| SMILES | Oc1cccc2c1NCC1(CCC1)CN2 |
| InChI | InChI=1S/C12H16N2O/c15-10-4-1-3-9-11(10)14-8-12(7-13-9)5-2-6-12/h1,3-4,13-15H,2,5-8H2 |
| InChIKey | BWMJUTCTXXBMFD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|