C13H16F2N2 — CID 115434710
6,7-difluorospiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclopentane] (PubChem CID 115434710) has the molecular formula C13H16F2N2 and a molecular weight of 238.28 g/mol. Its IUPAC name is 6,7-difluorospiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclopentane].
| Compound Name | 6,7-difluorospiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclopentane] |
|---|---|
| PubChem CID | 115434710 |
| Molecular Formula | C13H16F2N2 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 6,7-difluorospiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclopentane] |
| SMILES | Fc1ccc2c(c1F)NCC1(CCCC1)CN2 |
| InChI | InChI=1S/C13H16F2N2/c14-9-3-4-10-12(11(9)15)17-8-13(7-16-10)5-1-2-6-13/h3-4,16-17H,1-2,5-8H2 |
| InChIKey | KQZQGIKJNFGXTC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |