C12H15IN2 — CID 115447307
7-iodospiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclobutane] (PubChem CID 115447307) has the molecular formula C12H15IN2 and a molecular weight of 314.17 g/mol. Its IUPAC name is 7-iodospiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclobutane].
| Compound Name | 7-iodospiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclobutane] |
|---|---|
| PubChem CID | 115447307 |
| Molecular Formula | C12H15IN2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 7-iodospiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclobutane] |
| SMILES | Ic1ccc2c(c1)NCC1(CCC1)CN2 |
| InChI | InChI=1S/C12H15IN2/c13-9-2-3-10-11(6-9)15-8-12(7-14-10)4-1-5-12/h2-3,6,14-15H,1,4-5,7-8H2 |
| InChIKey | MSZOFXILPWFUIG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|