C12H17N3 — CID 115099979
spiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclobutane]-7-amine (PubChem CID 115099979) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is spiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclobutane]-7-amine.
| Compound Name | spiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclobutane]-7-amine |
|---|---|
| PubChem CID | 115099979 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | spiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclobutane]-7-amine |
| SMILES | Nc1ccc2c(c1)NCC1(CCC1)CN2 |
| InChI | InChI=1S/C12H17N3/c13-9-2-3-10-11(6-9)15-8-12(7-14-10)4-1-5-12/h2-3,6,14-15H,1,4-5,7-8,13H2 |
| InChIKey | DPLWVZASWRPSJT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|