C13H18N2O — CID 115099509
spiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclopentane]-6-ol (PubChem CID 115099509) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is spiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclopentane]-6-ol.
| Compound Name | spiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclopentane]-6-ol |
|---|---|
| PubChem CID | 115099509 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | spiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclopentane]-6-ol |
| SMILES | Oc1cccc2c1NCC1(CCCC1)CN2 |
| InChI | InChI=1S/C13H18N2O/c16-11-5-3-4-10-12(11)15-9-13(8-14-10)6-1-2-7-13/h3-5,14-16H,1-2,6-9H2 |
| InChIKey | GZOMRZZKFWTQPA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|