C10H12N2O — CID 115096997
spiro[3,4-dihydro-1H-quinoxaline-2,1'-cyclopropane]-5-ol (PubChem CID 115096997) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is spiro[3,4-dihydro-1H-quinoxaline-2,1'-cyclopropane]-5-ol.
| Compound Name | spiro[3,4-dihydro-1H-quinoxaline-2,1'-cyclopropane]-5-ol |
|---|---|
| PubChem CID | 115096997 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | spiro[3,4-dihydro-1H-quinoxaline-2,1'-cyclopropane]-5-ol |
| SMILES | Oc1cccc2c1NCC1(CC1)N2 |
| InChI | InChI=1S/C10H12N2O/c13-8-3-1-2-7-9(8)11-6-10(12-7)4-5-10/h1-3,11-13H,4-6H2 |
| InChIKey | SUMUADSRPSFNMI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|