C11H15NO — CID 84717906
3,3-dimethyl-2,4-dihydro-1H-quinolin-8-ol (PubChem CID 84717906) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 3,3-dimethyl-2,4-dihydro-1H-quinolin-8-ol.
| Compound Name | 3,3-dimethyl-2,4-dihydro-1H-quinolin-8-ol |
|---|---|
| PubChem CID | 84717906 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 3,3-dimethyl-2,4-dihydro-1H-quinolin-8-ol |
| SMILES | CC1(C)CNc2c(O)cccc2C1 |
| InChI | InChI=1S/C11H15NO/c1-11(2)6-8-4-3-5-9(13)10(8)12-7-11/h3-5,12-13H,6-7H2,1-2H3 |
| InChIKey | KKFOAGCNBDBDDD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|