C9H10N2O2 — CID 130382326
2-methoxy-3,4-dihydroquinoxalin-5-ol (PubChem CID 130382326) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-methoxy-3,4-dihydroquinoxalin-5-ol.
| Compound Name | 2-methoxy-3,4-dihydroquinoxalin-5-ol |
|---|---|
| PubChem CID | 130382326 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2-methoxy-3,4-dihydroquinoxalin-5-ol |
| SMILES | COC1=Nc2cccc(O)c2NC1 |
| InChI | InChI=1S/C9H10N2O2/c1-13-8-5-10-9-6(11-8)3-2-4-7(9)12/h2-4,10,12H,5H2,1H3 |
| InChIKey | CXGKEOKVLCYJMJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|