C13H15NO2S — CID 24977543
2-thia-9-azabicyclo[9.4.0]pentadeca-1(15),11,13-triene-3,10-dione (PubChem CID 24977543) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is 2-thia-9-azabicyclo[9.4.0]pentadeca-1(15),11,13-triene-3,10-dione.
| Compound Name | 2-thia-9-azabicyclo[9.4.0]pentadeca-1(15),11,13-triene-3,10-dione |
|---|---|
| PubChem CID | 24977543 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2-thia-9-azabicyclo[9.4.0]pentadeca-1(15),11,13-triene-3,10-dione |
| SMILES | O=C1CCCCCNC(=O)c2ccccc2S1 |
| InChI | InChI=1S/C13H15NO2S/c15-12-8-2-1-5-9-14-13(16)10-6-3-4-7-11(10)17-12/h3-4,6-7H,1-2,5,8-9H2,(H,14,16) |
| InChIKey | WZGKLASMWOLLEI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|