C13H15NO2 — CID 154328420
1,2,4,5,6,7-hexahydro-4-benzazecine-3,8-dione (PubChem CID 154328420) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 1,2,4,5,6,7-hexahydro-4-benzazecine-3,8-dione.
| Compound Name | 1,2,4,5,6,7-hexahydro-4-benzazecine-3,8-dione |
|---|---|
| PubChem CID | 154328420 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1,2,4,5,6,7-hexahydro-4-benzazecine-3,8-dione |
| SMILES | O=C1CCc2ccccc2C(=O)CCCN1 |
| InChI | InChI=1S/C13H15NO2/c15-12-6-3-9-14-13(16)8-7-10-4-1-2-5-11(10)12/h1-2,4-5H,3,6-9H2,(H,14,16) |
| InChIKey | ULBJIFAUAZIJLH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |