C14H15NOS — CID 163941307
8-amino-5-methyl-1,2,3,4-tetrahydrothioxanthen-9-one (PubChem CID 163941307) has the molecular formula C14H15NOS and a molecular weight of 245.35 g/mol. Its IUPAC name is 8-amino-5-methyl-1,2,3,4-tetrahydrothioxanthen-9-one.
| Compound Name | 8-amino-5-methyl-1,2,3,4-tetrahydrothioxanthen-9-one |
|---|---|
| PubChem CID | 163941307 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 8-amino-5-methyl-1,2,3,4-tetrahydrothioxanthen-9-one |
| SMILES | Cc1ccc(N)c2c(=O)c3c(sc12)CCCC3 |
| InChI | InChI=1S/C14H15NOS/c1-8-6-7-10(15)12-13(16)9-4-2-3-5-11(9)17-14(8)12/h6-7H,2-5,15H2,1H3 |
| InChIKey | RRFBMKZRCDSKNY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|