C7H13NO5S — CID 105480386
4-(aminooxymethyl)-1,1-dioxothiane-4-carboxylic acid (PubChem CID 105480386) has the molecular formula C7H13NO5S and a molecular weight of 223.25 g/mol. Its IUPAC name is 4-(aminooxymethyl)-1,1-dioxothiane-4-carboxylic acid.
| Compound Name | 4-(aminooxymethyl)-1,1-dioxothiane-4-carboxylic acid |
|---|---|
| PubChem CID | 105480386 |
| Molecular Formula | C7H13NO5S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 4-(aminooxymethyl)-1,1-dioxothiane-4-carboxylic acid |
| SMILES | NOCC1(C(=O)O)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C7H13NO5S/c8-13-5-7(6(9)10)1-3-14(11,12)4-2-7/h1-5,8H2,(H,9,10) |
| InChIKey | LNIBLJCUTOYKSN-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|