C9H18FNO2S — CID 105480915
2-(1,1-dioxothian-4-yl)-2-fluoro-N-methylpropan-1-amine (PubChem CID 105480915) has the molecular formula C9H18FNO2S and a molecular weight of 223.31 g/mol. Its IUPAC name is 2-(1,1-dioxothian-4-yl)-2-fluoro-N-methylpropan-1-amine.
| Compound Name | 2-(1,1-dioxothian-4-yl)-2-fluoro-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 105480915 |
| Molecular Formula | C9H18FNO2S |
| Molecular Weight | 223.31 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-(1,1-dioxothian-4-yl)-2-fluoro-N-methylpropan-1-amine |
| SMILES | CNCC(C)(F)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H18FNO2S/c1-9(10,7-11-2)8-3-5-14(12,13)6-4-8/h8,11H,3-7H2,1-2H3 |
| InChIKey | BHWFBXGXMAPUMU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |