C10H10O4S — CID 105483830
4-hydroxy-1,1-dioxo-3,4-dihydro-2H-thiochromene-6-carbaldehyde (PubChem CID 105483830) has the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. Its IUPAC name is 4-hydroxy-1,1-dioxo-3,4-dihydro-2H-thiochromene-6-carbaldehyde.
| Compound Name | 4-hydroxy-1,1-dioxo-3,4-dihydro-2H-thiochromene-6-carbaldehyde |
|---|---|
| PubChem CID | 105483830 |
| Molecular Formula | C10H10O4S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 4-hydroxy-1,1-dioxo-3,4-dihydro-2H-thiochromene-6-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)C(O)CCS2(=O)=O |
| InChI | InChI=1S/C10H10O4S/c11-6-7-1-2-10-8(5-7)9(12)3-4-15(10,13)14/h1-2,5-6,9,12H,3-4H2 |
| InChIKey | AZCDQFJHKCIRJO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|