C10H12O3S — CID 167516990
6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol (PubChem CID 167516990) has the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. Its IUPAC name is 6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol.
| Compound Name | 6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol |
|---|---|
| PubChem CID | 167516990 |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-ol |
| SMILES | Cc1ccc2c(c1)C(O)CCS2(=O)=O |
| InChI | InChI=1S/C10H12O3S/c1-7-2-3-10-8(6-7)9(11)4-5-14(10,12)13/h2-3,6,9,11H,4-5H2,1H3 |
| InChIKey | FZZAMSVUDDPMLD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |