About 3-(2-aminophenyl)-1,1-dioxothiolan-3-ol
3-(2-aminophenyl)-1,1-dioxothiolan-3-ol (PubChem CID 105484641) has the molecular formula C10H13NO3S
and a molecular weight of 227.28 g/mol. Its IUPAC name is 3-(2-aminophenyl)-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 3-(2-aminophenyl)-1,1-dioxothiolan-3-ol |
| PubChem CID | 105484641 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 3-(2-aminophenyl)-1,1-dioxothiolan-3-ol |
| SMILES | Nc1ccccc1C1(O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H13NO3S/c11-9-4-2-1-3-8(9)10(12)5-6-15(13,14)7-10/h1-4,12H,5-7,11H2 |
| InChIKey | DRUFKEOOKMWQIB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-aminophenyl)-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminophenyl)-1,1-dioxothiolan-3-ol?
The IUPAC name of 3-(2-aminophenyl)-1,1-dioxothiolan-3-ol (CID 105484641) is 3-(2-aminophenyl)-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 3-(2-aminophenyl)-1,1-dioxothiolan-3-ol?
The canonical SMILES for 3-(2-aminophenyl)-1,1-dioxothiolan-3-ol is Nc1ccccc1C1(O)CCS(=O)(=O)C1.
What is the InChIKey of 3-(2-aminophenyl)-1,1-dioxothiolan-3-ol?
The InChIKey is DRUFKEOOKMWQIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3S/c11-9-4-2-1-3-8(9)10(12)5-6-15(13,14)7-10/h1-4,12H,5-7,11H2.
What are the key properties of 3-(2-aminophenyl)-1,1-dioxothiolan-3-ol?
3-(2-aminophenyl)-1,1-dioxothiolan-3-ol has a molecular weight of 227.28 g/mol, XLogP of 0.27, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminophenyl)-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 105484641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).