C10H9F3N2O — CID 105487507
1-[3-(trifluoromethyl)-1,2-benzoxazol-7-yl]ethanamine (PubChem CID 105487507) has the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)-1,2-benzoxazol-7-yl]ethanamine.
| Compound Name | 1-[3-(trifluoromethyl)-1,2-benzoxazol-7-yl]ethanamine |
|---|---|
| PubChem CID | 105487507 |
| Molecular Formula | C10H9F3N2O |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1-[3-(trifluoromethyl)-1,2-benzoxazol-7-yl]ethanamine |
| SMILES | CC(N)c1cccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C10H9F3N2O/c1-5(14)6-3-2-4-7-8(6)16-15-9(7)10(11,12)13/h2-5H,14H2,1H3 |
| InChIKey | DUHVXPUFWIWMOO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |