C9H13NO4S — CID 105489473
2-(2-oxo-1-oxa-9-thia-3-azaspiro[4.5]decan-3-yl)acetic acid (PubChem CID 105489473) has the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. Its IUPAC name is 2-(2-oxo-1-oxa-9-thia-3-azaspiro[4.5]decan-3-yl)acetic acid.
| Compound Name | 2-(2-oxo-1-oxa-9-thia-3-azaspiro[4.5]decan-3-yl)acetic acid |
|---|---|
| PubChem CID | 105489473 |
| Molecular Formula | C9H13NO4S |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 2-(2-oxo-1-oxa-9-thia-3-azaspiro[4.5]decan-3-yl)acetic acid |
| SMILES | O=C(O)CN1CC2(CCCSC2)OC1=O |
| InChI | InChI=1S/C9H13NO4S/c11-7(12)4-10-5-9(14-8(10)13)2-1-3-15-6-9/h1-6H2,(H,11,12) |
| InChIKey | WPKOVSCDQPKOGY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |