C15H25N5O5 — CID 22975624
2-[8-[5-(diaminomethylideneamino)pentanoyl]-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]acetic acid (PubChem CID 22975624) has the molecular formula C15H25N5O5 and a molecular weight of 355.40 g/mol. Its IUPAC name is 2-[8-[5-(diaminomethylideneamino)pentanoyl]-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]acetic acid.
| Compound Name | 2-[8-[5-(diaminomethylideneamino)pentanoyl]-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]acetic acid |
|---|---|
| PubChem CID | 22975624 |
| Molecular Formula | C15H25N5O5 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-[8-[5-(diaminomethylideneamino)pentanoyl]-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]acetic acid |
| SMILES | NC(N)=NCCCCC(=O)N1CCC2(CC1)CN(CC(=O)O)C(=O)O2 |
| InChI | InChI=1S/C15H25N5O5/c16-13(17)18-6-2-1-3-11(21)19-7-4-15(5-8-19)10-20(9-12(22)23)14(24)25-15/h1-10H2,(H,22,23)(H4,16,17,18) |
| InChIKey | LBOLEDBCJIRBOE-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 151.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|