C23H30N3O7- — CID 23435706
2-[2-oxo-8-[6-(phenylmethoxycarbonylamino)hexanoyl]-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 23435706) has the molecular formula C23H30N3O7- and a molecular weight of 460.51 g/mol. Its IUPAC name is 2-[2-oxo-8-[6-(phenylmethoxycarbonylamino)hexanoyl]-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | 2-[2-oxo-8-[6-(phenylmethoxycarbonylamino)hexanoyl]-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 23435706 |
| Molecular Formula | C23H30N3O7- |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 2-[2-oxo-8-[6-(phenylmethoxycarbonylamino)hexanoyl]-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | O=C([O-])CN1CC2(CCN(C(=O)CCCCCNC(=O)OCc3ccccc3)CC2)OC1=O |
| InChI | InChI=1S/C23H31N3O7/c27-19(9-5-2-6-12-24-21(30)32-16-18-7-3-1-4-8-18)25-13-10-23(11-14-25)17-26(15-20(28)29)22(31)33-23/h1,3-4,7-8H,2,5-6,9-17H2,(H,24,30)(H,28,29)/p-1 |
| InChIKey | ITIZYJNVGVYIFO-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|