C24H38N4O9 — CID 173242663
2-[8-[6-[(2-methylpropan-2-yl)oxy]-5-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]-6-oxohexanoyl]-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]acetic acid (PubChem CID 173242663) has the molecular formula C24H38N4O9 and a molecular weight of 526.59 g/mol. Its IUPAC name is 2-[8-[6-[(2-methylpropan-2-yl)oxy]-5-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]-6-oxohexanoyl]-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]acetic acid.
| Compound Name | 2-[8-[6-[(2-methylpropan-2-yl)oxy]-5-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]-6-oxohexanoyl]-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]acetic acid |
|---|---|
| PubChem CID | 173242663 |
| Molecular Formula | C24H38N4O9 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | 2-[8-[6-[(2-methylpropan-2-yl)oxy]-5-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]-6-oxohexanoyl]-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]acetic acid |
| SMILES | CC(C)(C)OC(=O)NN=C(CCCC(=O)N1CCC2(CC1)CN(CC(=O)O)C(=O)O2)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38N4O9/c1-22(2,3)35-19(32)16(25-26-20(33)36-23(4,5)6)8-7-9-17(29)27-12-10-24(11-13-27)15-28(14-18(30)31)21(34)37-24/h7-15H2,1-6H3,(H,26,33)(H,30,31) |
| InChIKey | CIWLXUSXPFROSN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 164.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|