C15H22ClFN2O5 — CID 166427535
tert-butyl 2-[8-(2-chloro-2-fluoroacetyl)-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 166427535) has the molecular formula C15H22ClFN2O5 and a molecular weight of 364.80 g/mol. Its IUPAC name is tert-butyl 2-[8-(2-chloro-2-fluoroacetyl)-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | tert-butyl 2-[8-(2-chloro-2-fluoroacetyl)-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 166427535 |
| Molecular Formula | C15H22ClFN2O5 |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | tert-butyl 2-[8-(2-chloro-2-fluoroacetyl)-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CC2(CCN(C(=O)C(F)Cl)CC2)OC1=O |
| InChI | InChI=1S/C15H22ClFN2O5/c1-14(2,3)23-10(20)8-19-9-15(24-13(19)22)4-6-18(7-5-15)12(21)11(16)17/h11H,4-9H2,1-3H3 |
| InChIKey | WPOHMMTZSUMRIQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|