C10H10F3NO2 — CID 105492147
methyl 2-amino-3,3-difluoro-3-(2-fluorophenyl)propanoate (PubChem CID 105492147) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is methyl 2-amino-3,3-difluoro-3-(2-fluorophenyl)propanoate.
| Compound Name | methyl 2-amino-3,3-difluoro-3-(2-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 105492147 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | methyl 2-amino-3,3-difluoro-3-(2-fluorophenyl)propanoate |
| SMILES | COC(=O)C(N)C(F)(F)c1ccccc1F |
| InChI | InChI=1S/C10H10F3NO2/c1-16-9(15)8(14)10(12,13)6-4-2-3-5-7(6)11/h2-5,8H,14H2,1H3 |
| InChIKey | OFNRVZJBIMBRKK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |