C10H12ClF2NO4 — CID 129320162
methyl 2-amino-3-(3,4-dihydroxyphenyl)-3,3-difluoropropanoate;hydrochloride (PubChem CID 129320162) has the molecular formula C10H12ClF2NO4 and a molecular weight of 283.66 g/mol. Its IUPAC name is methyl 2-amino-3-(3,4-dihydroxyphenyl)-3,3-difluoropropanoate;hydrochloride.
| Compound Name | methyl 2-amino-3-(3,4-dihydroxyphenyl)-3,3-difluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 129320162 |
| Molecular Formula | C10H12ClF2NO4 |
| Molecular Weight | 283.66 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | methyl 2-amino-3-(3,4-dihydroxyphenyl)-3,3-difluoropropanoate;hydrochloride |
| SMILES | COC(=O)C(N)C(F)(F)c1ccc(O)c(O)c1.Cl |
| InChI | InChI=1S/C10H11F2NO4.ClH/c1-17-9(16)8(13)10(11,12)5-2-3-6(14)7(15)4-5;/h2-4,8,14-15H,13H2,1H3;1H |
| InChIKey | ACMPKPZFJWCFNS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.66 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|