3-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-6-yl)propanoic acid

C14H19NO2 — CID 105493043

IUPAC3-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-6-yl)propanoic acid
SMILESCN1CCCc2c(CCC(=O)O)cccc2C1
InChIInChI=1S/C14H19NO2/c1-15-9-3-6-13-11(7-8-14(16)17)4-2-5-12(13)10-15/h2,4-5H,3,6-10H2,1H3,(H,16,17)
InChIKeyFYXATDAWFBGYPY-UHFFFAOYSA-N
MW233.31 g/mol
LogP2.08
Rot. Bonds3

About 3-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-6-yl)propanoic acid

3-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-6-yl)propanoic acid (PubChem CID 105493043) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-6-yl)propanoic acid.

Molecular Properties

Compound Name3-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-6-yl)propanoic acid
PubChem CID105493043
Molecular FormulaC14H19NO2
Molecular Weight233.31 g/mol
Exact Mass233.14
IUPAC Name3-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-6-yl)propanoic acid
SMILESCN1CCCc2c(CCC(=O)O)cccc2C1
InChIInChI=1S/C14H19NO2/c1-15-9-3-6-13-11(7-8-14(16)17)4-2-5-12(13)10-15/h2,4-5H,3,6-10H2,1H3,(H,16,17)
InChIKeyFYXATDAWFBGYPY-UHFFFAOYSA-N
XLogP2.08
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.31
LogP ≤ 52.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-6-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-6-yl)propanoic acid?
The IUPAC name of 3-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-6-yl)propanoic acid (CID 105493043) is 3-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-6-yl)propanoic acid.
What is the SMILES notation for 3-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-6-yl)propanoic acid?
The canonical SMILES for 3-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-6-yl)propanoic acid is CN1CCCc2c(CCC(=O)O)cccc2C1.
What is the InChIKey of 3-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-6-yl)propanoic acid?
The InChIKey is FYXATDAWFBGYPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-15-9-3-6-13-11(7-8-14(16)17)4-2-5-12(13)10-15/h2,4-5H,3,6-10H2,1H3,(H,16,17).
What are the key properties of 3-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-6-yl)propanoic acid?
3-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-6-yl)propanoic acid has a molecular weight of 233.31 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methyl-1,3,4,5-tetrahydro-2-benzazepin-6-yl)propanoic acid is sourced from PubChem (CID 105493043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).