C13H19NO — CID 105457923
1-(2-methyl-3,4-dihydro-1H-isoquinolin-5-yl)propan-2-ol (PubChem CID 105457923) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(2-methyl-3,4-dihydro-1H-isoquinolin-5-yl)propan-2-ol.
| Compound Name | 1-(2-methyl-3,4-dihydro-1H-isoquinolin-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 105457923 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-(2-methyl-3,4-dihydro-1H-isoquinolin-5-yl)propan-2-ol |
| SMILES | CC(O)Cc1cccc2c1CCN(C)C2 |
| InChI | InChI=1S/C13H19NO/c1-10(15)8-11-4-3-5-12-9-14(2)7-6-13(11)12/h3-5,10,15H,6-9H2,1-2H3 |
| InChIKey | PJQXWLBKYSZSIW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |