C9H12F3N3O — CID 105495722
2-[4-methoxy-2-methyl-6-(trifluoromethyl)pyrimidin-5-yl]ethanamine (PubChem CID 105495722) has the molecular formula C9H12F3N3O and a molecular weight of 235.21 g/mol. Its IUPAC name is 2-[4-methoxy-2-methyl-6-(trifluoromethyl)pyrimidin-5-yl]ethanamine.
| Compound Name | 2-[4-methoxy-2-methyl-6-(trifluoromethyl)pyrimidin-5-yl]ethanamine |
|---|---|
| PubChem CID | 105495722 |
| Molecular Formula | C9H12F3N3O |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 2-[4-methoxy-2-methyl-6-(trifluoromethyl)pyrimidin-5-yl]ethanamine |
| SMILES | COc1nc(C)nc(C(F)(F)F)c1CCN |
| InChI | InChI=1S/C9H12F3N3O/c1-5-14-7(9(10,11)12)6(3-4-13)8(15-5)16-2/h3-4,13H2,1-2H3 |
| InChIKey | ZPINREOJKNMLPS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |