About 2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]pyrrolidine
2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]pyrrolidine (PubChem CID 105496479) has the molecular formula C14H18FNO
and a molecular weight of 235.30 g/mol. Its IUPAC name is 2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]pyrrolidine.
Molecular Properties
| Compound Name | 2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]pyrrolidine |
| PubChem CID | 105496479 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]pyrrolidine |
| SMILES | Fc1ccc2c(c1)C(CC1CCCN1)CCO2 |
| InChI | InChI=1S/C14H18FNO/c15-11-3-4-14-13(9-11)10(5-7-17-14)8-12-2-1-6-16-12/h3-4,9-10,12,16H,1-2,5-8H2 |
| InChIKey | BKOUBFGYYNIJGX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]pyrrolidine?
The IUPAC name of 2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]pyrrolidine (CID 105496479) is 2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]pyrrolidine.
What is the SMILES notation for 2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]pyrrolidine?
The canonical SMILES for 2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]pyrrolidine is Fc1ccc2c(c1)C(CC1CCCN1)CCO2.
What is the InChIKey of 2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]pyrrolidine?
The InChIKey is BKOUBFGYYNIJGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FNO/c15-11-3-4-14-13(9-11)10(5-7-17-14)8-12-2-1-6-16-12/h3-4,9-10,12,16H,1-2,5-8H2.
What are the key properties of 2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]pyrrolidine?
2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]pyrrolidine has a molecular weight of 235.30 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]pyrrolidine is sourced from PubChem (CID 105496479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).