C9H8ClF2NO2 — CID 105497059
2-amino-2-(2-chlorophenyl)-3,3-difluoropropanoic acid (PubChem CID 105497059) has the molecular formula C9H8ClF2NO2 and a molecular weight of 235.62 g/mol. Its IUPAC name is 2-amino-2-(2-chlorophenyl)-3,3-difluoropropanoic acid.
| Compound Name | 2-amino-2-(2-chlorophenyl)-3,3-difluoropropanoic acid |
|---|---|
| PubChem CID | 105497059 |
| Molecular Formula | C9H8ClF2NO2 |
| Molecular Weight | 235.62 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 2-amino-2-(2-chlorophenyl)-3,3-difluoropropanoic acid |
| SMILES | NC(C(=O)O)(c1ccccc1Cl)C(F)F |
| InChI | InChI=1S/C9H8ClF2NO2/c10-6-4-2-1-3-5(6)9(13,7(11)12)8(14)15/h1-4,7H,13H2,(H,14,15) |
| InChIKey | YJXXJPHTTPVFKF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.62 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |