C27H30N2O2 — CID 10549730
(3aS,8bS)-3,4-dibenzyl-6,6,8b-trimethyl-1,3a,5,7-tetrahydropyrrolo[2,3-b]indole-2,8-dione (PubChem CID 10549730) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is (3aS,8bS)-3,4-dibenzyl-6,6,8b-trimethyl-1,3a,5,7-tetrahydropyrrolo[2,3-b]indole-2,8-dione.
| Compound Name | (3aS,8bS)-3,4-dibenzyl-6,6,8b-trimethyl-1,3a,5,7-tetrahydropyrrolo[2,3-b]indole-2,8-dione |
|---|---|
| PubChem CID | 10549730 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (3aS,8bS)-3,4-dibenzyl-6,6,8b-trimethyl-1,3a,5,7-tetrahydropyrrolo[2,3-b]indole-2,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(Cc1ccccc1)[C@H]1N(Cc3ccccc3)C(=O)C[C@@]21C |
| InChI | InChI=1S/C27H30N2O2/c1-26(2)14-21-24(22(30)15-26)27(3)16-23(31)29(18-20-12-8-5-9-13-20)25(27)28(21)17-19-10-6-4-7-11-19/h4-13,25H,14-18H2,1-3H3/t25-,27-/m0/s1 |
| InChIKey | RUPDFJPCQWSNRL-BDYUSTAISA-N |
| XLogP | 4.91 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |