C23H24N2O3 — CID 134840302
3-(2-aminophenyl)-1-benzyl-3-hydroxy-6,6-dimethyl-5,7-dihydroindole-2,4-dione (PubChem CID 134840302) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-(2-aminophenyl)-1-benzyl-3-hydroxy-6,6-dimethyl-5,7-dihydroindole-2,4-dione.
| Compound Name | 3-(2-aminophenyl)-1-benzyl-3-hydroxy-6,6-dimethyl-5,7-dihydroindole-2,4-dione |
|---|---|
| PubChem CID | 134840302 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-(2-aminophenyl)-1-benzyl-3-hydroxy-6,6-dimethyl-5,7-dihydroindole-2,4-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(Cc1ccccc1)C(=O)C2(O)c1ccccc1N |
| InChI | InChI=1S/C23H24N2O3/c1-22(2)12-18-20(19(26)13-22)23(28,16-10-6-7-11-17(16)24)21(27)25(18)14-15-8-4-3-5-9-15/h3-11,28H,12-14,24H2,1-2H3 |
| InChIKey | OIRMAMZUGQRUAE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|