C21H28N2O2 — CID 11887386
(4R,4aR,9aS)-9-benzyl-4-hydroxy-2,7,7-trimethyl-3,4,4a,6,8,9a-hexahydro-1H-pyrido[3,4-b]indol-5-one (PubChem CID 11887386) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is (4R,4aR,9aS)-9-benzyl-4-hydroxy-2,7,7-trimethyl-3,4,4a,6,8,9a-hexahydro-1H-pyrido[3,4-b]indol-5-one.
| Compound Name | (4R,4aR,9aS)-9-benzyl-4-hydroxy-2,7,7-trimethyl-3,4,4a,6,8,9a-hexahydro-1H-pyrido[3,4-b]indol-5-one |
|---|---|
| PubChem CID | 11887386 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (4R,4aR,9aS)-9-benzyl-4-hydroxy-2,7,7-trimethyl-3,4,4a,6,8,9a-hexahydro-1H-pyrido[3,4-b]indol-5-one |
| SMILES | CN1C[C@@H]2[C@@H](C3=C(CC(C)(C)CC3=O)N2Cc2ccccc2)[C@@H](O)C1 |
| InChI | InChI=1S/C21H28N2O2/c1-21(2)9-15-19(17(24)10-21)20-16(12-22(3)13-18(20)25)23(15)11-14-7-5-4-6-8-14/h4-8,16,18,20,25H,9-13H2,1-3H3/t16-,18+,20-/m1/s1 |
| InChIKey | KOHMZZHVNVAGOM-IMFGXOCKSA-N |
| XLogP | 2.44 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |