C14H24N2O — CID 105498185
2-(1-cycloheptyl-3,5-dimethylpyrazol-4-yl)ethanol (PubChem CID 105498185) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-(1-cycloheptyl-3,5-dimethylpyrazol-4-yl)ethanol.
| Compound Name | 2-(1-cycloheptyl-3,5-dimethylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 105498185 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 2-(1-cycloheptyl-3,5-dimethylpyrazol-4-yl)ethanol |
| SMILES | Cc1nn(C2CCCCCC2)c(C)c1CCO |
| InChI | InChI=1S/C14H24N2O/c1-11-14(9-10-17)12(2)16(15-11)13-7-5-3-4-6-8-13/h13,17H,3-10H2,1-2H3 |
| InChIKey | VBZVJVWWWKBTAP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |