C15H27N3 — CID 79225212
3-(1-cycloheptyl-3,5-dimethylpyrazol-4-yl)propan-1-amine (PubChem CID 79225212) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 3-(1-cycloheptyl-3,5-dimethylpyrazol-4-yl)propan-1-amine.
| Compound Name | 3-(1-cycloheptyl-3,5-dimethylpyrazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 79225212 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 3-(1-cycloheptyl-3,5-dimethylpyrazol-4-yl)propan-1-amine |
| SMILES | Cc1nn(C2CCCCCC2)c(C)c1CCCN |
| InChI | InChI=1S/C15H27N3/c1-12-15(10-7-11-16)13(2)18(17-12)14-8-5-3-4-6-9-14/h14H,3-11,16H2,1-2H3 |
| InChIKey | UYRKFCVAVABVJC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |