C12H20N2O2 — CID 105482134
3-[3,5-dimethyl-1-(oxolan-3-yl)pyrazol-4-yl]propan-1-ol (PubChem CID 105482134) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-[3,5-dimethyl-1-(oxolan-3-yl)pyrazol-4-yl]propan-1-ol.
| Compound Name | 3-[3,5-dimethyl-1-(oxolan-3-yl)pyrazol-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 105482134 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 3-[3,5-dimethyl-1-(oxolan-3-yl)pyrazol-4-yl]propan-1-ol |
| SMILES | Cc1nn(C2CCOC2)c(C)c1CCCO |
| InChI | InChI=1S/C12H20N2O2/c1-9-12(4-3-6-15)10(2)14(13-9)11-5-7-16-8-11/h11,15H,3-8H2,1-2H3 |
| InChIKey | XXUMZWXDNVNECS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |