C16H26N2O5 — CID 143009416
2-[4-ethyl-5-methyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol (PubChem CID 143009416) has the molecular formula C16H26N2O5 and a molecular weight of 326.39 g/mol. Its IUPAC name is 2-[4-ethyl-5-methyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | 2-[4-ethyl-5-methyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 143009416 |
| Molecular Formula | C16H26N2O5 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 2-[4-ethyl-5-methyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol |
| SMILES | CCc1c(OC2CC(O)CC(CO)O2)nn(C2CCOC2)c1C |
| InChI | InChI=1S/C16H26N2O5/c1-3-14-10(2)18(11-4-5-21-9-11)17-16(14)23-15-7-12(20)6-13(8-19)22-15/h11-13,15,19-20H,3-9H2,1-2H3 |
| InChIKey | OQMJDMBYIWOFTH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |