C10H20FNO2S — CID 105499496
3-(1,1-dioxothian-4-yl)-3-fluoro-N-methylbutan-1-amine (PubChem CID 105499496) has the molecular formula C10H20FNO2S and a molecular weight of 237.34 g/mol. Its IUPAC name is 3-(1,1-dioxothian-4-yl)-3-fluoro-N-methylbutan-1-amine.
| Compound Name | 3-(1,1-dioxothian-4-yl)-3-fluoro-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 105499496 |
| Molecular Formula | C10H20FNO2S |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-(1,1-dioxothian-4-yl)-3-fluoro-N-methylbutan-1-amine |
| SMILES | CNCCC(C)(F)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H20FNO2S/c1-10(11,5-6-12-2)9-3-7-15(13,14)8-4-9/h9,12H,3-8H2,1-2H3 |
| InChIKey | WFEXXHWLVNOYSV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |