C28H34N2O2 — CID 10550591
1-cycloheptyl-1-[(5-phenylfuran-2-yl)methyl]-3-(2,4,6-trimethylphenyl)urea (PubChem CID 10550591) has the molecular formula C28H34N2O2 and a molecular weight of 430.59 g/mol. Its IUPAC name is 1-cycloheptyl-1-[(5-phenylfuran-2-yl)methyl]-3-(2,4,6-trimethylphenyl)urea.
| Compound Name | 1-cycloheptyl-1-[(5-phenylfuran-2-yl)methyl]-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| PubChem CID | 10550591 |
| Molecular Formula | C28H34N2O2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 1-cycloheptyl-1-[(5-phenylfuran-2-yl)methyl]-3-(2,4,6-trimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)N(Cc2ccc(-c3ccccc3)o2)C2CCCCCC2)c(C)c1 |
| InChI | InChI=1S/C28H34N2O2/c1-20-17-21(2)27(22(3)18-20)29-28(31)30(24-13-9-4-5-10-14-24)19-25-15-16-26(32-25)23-11-7-6-8-12-23/h6-8,11-12,15-18,24H,4-5,9-10,13-14,19H2,1-3H3,(H,29,31) |
| InChIKey | PQLPKWPEJNNPJH-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |