C28H24F3NO4 — CID 10553276
ethyl 2-ethyl-8-phenylmethoxy-3-[3-(trifluoromethyl)benzoyl]indolizine-1-carboxylate (PubChem CID 10553276) has the molecular formula C28H24F3NO4 and a molecular weight of 495.50 g/mol. Its IUPAC name is ethyl 2-ethyl-8-phenylmethoxy-3-[3-(trifluoromethyl)benzoyl]indolizine-1-carboxylate.
| Compound Name | ethyl 2-ethyl-8-phenylmethoxy-3-[3-(trifluoromethyl)benzoyl]indolizine-1-carboxylate |
|---|---|
| PubChem CID | 10553276 |
| Molecular Formula | C28H24F3NO4 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | ethyl 2-ethyl-8-phenylmethoxy-3-[3-(trifluoromethyl)benzoyl]indolizine-1-carboxylate |
| SMILES | CCOC(=O)c1c(CC)c(C(=O)c2cccc(C(F)(F)F)c2)n2cccc(OCc3ccccc3)c12 |
| InChI | InChI=1S/C28H24F3NO4/c1-3-21-23(27(34)35-4-2)25-22(36-17-18-10-6-5-7-11-18)14-9-15-32(25)24(21)26(33)19-12-8-13-20(16-19)28(29,30)31/h5-16H,3-4,17H2,1-2H3 |
| InChIKey | PPBHZKHYQNXGAU-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |