C25H23BrN2O5 — CID 10553760
3-benzoyl-1-[2-bromo-1-[(2R)-1-phenylmethoxybut-3-yn-2-yl]oxyethyl]-5-methylpyrimidine-2,4-dione (PubChem CID 10553760) has the molecular formula C25H23BrN2O5 and a molecular weight of 511.37 g/mol. Its IUPAC name is 3-benzoyl-1-[2-bromo-1-[(2R)-1-phenylmethoxybut-3-yn-2-yl]oxyethyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 3-benzoyl-1-[2-bromo-1-[(2R)-1-phenylmethoxybut-3-yn-2-yl]oxyethyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10553760 |
| Molecular Formula | C25H23BrN2O5 |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 3-benzoyl-1-[2-bromo-1-[(2R)-1-phenylmethoxybut-3-yn-2-yl]oxyethyl]-5-methylpyrimidine-2,4-dione |
| SMILES | C#C[C@H](COCc1ccccc1)OC(CBr)n1cc(C)c(=O)n(C(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C25H23BrN2O5/c1-3-21(17-32-16-19-10-6-4-7-11-19)33-22(14-26)27-15-18(2)23(29)28(25(27)31)24(30)20-12-8-5-9-13-20/h1,4-13,15,21-22H,14,16-17H2,2H3/t21-,22?/m1/s1 |
| InChIKey | YIZBDBVENVSZEQ-ZMFCMNQTSA-N |
| XLogP | 3.14 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|