C48H47N3O10 — CID 11977232
3-benzoyl-N-[(2R,3R,4S,5R,6R)-6-[(4-methoxyphenyl)methoxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]-5-methyl-2,4-dioxopyrimidine-1-carboxamide (PubChem CID 11977232) has the molecular formula C48H47N3O10 and a molecular weight of 825.92 g/mol. Its IUPAC name is 3-benzoyl-N-[(2R,3R,4S,5R,6R)-6-[(4-methoxyphenyl)methoxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]-5-methyl-2,4-dioxopyrimidine-1-carboxamide.
| Compound Name | 3-benzoyl-N-[(2R,3R,4S,5R,6R)-6-[(4-methoxyphenyl)methoxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]-5-methyl-2,4-dioxopyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 11977232 |
| Molecular Formula | C48H47N3O10 |
| Molecular Weight | 825.92 g/mol |
| Exact Mass | 825.33 |
| IUPAC Name | 3-benzoyl-N-[(2R,3R,4S,5R,6R)-6-[(4-methoxyphenyl)methoxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]-5-methyl-2,4-dioxopyrimidine-1-carboxamide |
| SMILES | COc1ccc(COC[C@H]2O[C@@H](NC(=O)n3cc(C)c(=O)n(C(=O)c4ccccc4)c3=O)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C48H47N3O10/c1-33-27-50(48(55)51(45(33)52)46(53)38-21-13-6-14-22-38)47(54)49-44-43(60-31-36-19-11-5-12-20-36)42(59-30-35-17-9-4-10-18-35)41(58-29-34-15-7-3-8-16-34)40(61-44)32-57-28-37-23-25-39(56-2)26-24-37/h3-27,40-44H,28-32H2,1-2H3,(H,49,54)/t40-,41-,42+,43-,44-/m1/s1 |
| InChIKey | DBRZHDVAIYZBQJ-LUKFIAJXSA-N |
| XLogP | 6.27 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.92 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |