C30H40N2O5Si — CID 90410666
3-benzoyl-1-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)butyl]-5-methylpyrimidine-2,4-dione (PubChem CID 90410666) has the molecular formula C30H40N2O5Si and a molecular weight of 536.75 g/mol. Its IUPAC name is 3-benzoyl-1-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)butyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 3-benzoyl-1-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)butyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90410666 |
| Molecular Formula | C30H40N2O5Si |
| Molecular Weight | 536.75 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 3-benzoyl-1-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)butyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(CC(COCc2ccccc2)[C@@H](C)O[Si](C)(C)C(C)(C)C)c(=O)n(C(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C30H40N2O5Si/c1-22-18-31(29(35)32(27(22)33)28(34)25-16-12-9-13-17-25)19-26(21-36-20-24-14-10-8-11-15-24)23(2)37-38(6,7)30(3,4)5/h8-18,23,26H,19-21H2,1-7H3/t23-,26?/m1/s1 |
| InChIKey | ROGLPOLSLVFAMV-GEPVFLLWSA-N |
| XLogP | 5.25 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.75 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|