C25H32O15 — CID 10555106
methyl (2S,3S,4S)-3-[(2R)-oxiran-2-yl]-4-(2-oxoethyl)-2-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate (PubChem CID 10555106) has the molecular formula C25H32O15 and a molecular weight of 572.52 g/mol. Its IUPAC name is methyl (2S,3S,4S)-3-[(2R)-oxiran-2-yl]-4-(2-oxoethyl)-2-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate.
| Compound Name | methyl (2S,3S,4S)-3-[(2R)-oxiran-2-yl]-4-(2-oxoethyl)-2-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 10555106 |
| Molecular Formula | C25H32O15 |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | methyl (2S,3S,4S)-3-[(2R)-oxiran-2-yl]-4-(2-oxoethyl)-2-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H]([C@@H]2CO2)[C@@H]1CC=O |
| InChI | InChI=1S/C25H32O15/c1-11(27)33-10-18-20(36-12(2)28)21(37-13(3)29)22(38-14(4)30)25(39-18)40-24-19(17-9-34-17)15(6-7-26)16(8-35-24)23(31)32-5/h7-8,15,17-22,24-25H,6,9-10H2,1-5H3/t15-,17+,18-,19+,20-,21+,22-,24+,25+/m1/s1 |
| InChIKey | JDCQQYHMSGZYRM-NYAWZZJCSA-N |
| XLogP | -0.28 |
| TPSA | 188.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|