C25H32O16 — CID 10745933
2-[(2S,3S,4S)-5-methoxycarbonyl-3-[(2S)-oxiran-2-yl]-2-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-4-yl]acetic acid (PubChem CID 10745933) has the molecular formula C25H32O16 and a molecular weight of 588.52 g/mol. Its IUPAC name is 2-[(2S,3S,4S)-5-methoxycarbonyl-3-[(2S)-oxiran-2-yl]-2-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-4-yl]acetic acid.
| Compound Name | 2-[(2S,3S,4S)-5-methoxycarbonyl-3-[(2S)-oxiran-2-yl]-2-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-4-yl]acetic acid |
|---|---|
| PubChem CID | 10745933 |
| Molecular Formula | C25H32O16 |
| Molecular Weight | 588.52 g/mol |
| Exact Mass | 588.17 |
| IUPAC Name | 2-[(2S,3S,4S)-5-methoxycarbonyl-3-[(2S)-oxiran-2-yl]-2-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-4-yl]acetic acid |
| SMILES | COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H]([C@H]2CO2)[C@@H]1CC(=O)O |
| InChI | InChI=1S/C25H32O16/c1-10(26)34-9-17-20(37-11(2)27)21(38-12(3)28)22(39-13(4)29)25(40-17)41-24-19(16-8-35-16)14(6-18(30)31)15(7-36-24)23(32)33-5/h7,14,16-17,19-22,24-25H,6,8-9H2,1-5H3,(H,30,31)/t14-,16-,17-,19+,20-,21+,22-,24+,25+/m1/s1 |
| InChIKey | UZYNLKPDROGNFR-BJLVLPFHSA-N |
| XLogP | -0.39 |
| TPSA | 209.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.52 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|