C25H32O15 — CID 11238486
methyl (1S,4aS,8aS)-1-methyl-3-oxo-8-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4,4a,8,8a-tetrahydro-1H-pyrano[3,4-c]pyran-5-carboxylate (PubChem CID 11238486) has the molecular formula C25H32O15 and a molecular weight of 572.52 g/mol. Its IUPAC name is methyl (1S,4aS,8aS)-1-methyl-3-oxo-8-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4,4a,8,8a-tetrahydro-1H-pyrano[3,4-c]pyran-5-carboxylate.
| Compound Name | methyl (1S,4aS,8aS)-1-methyl-3-oxo-8-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4,4a,8,8a-tetrahydro-1H-pyrano[3,4-c]pyran-5-carboxylate |
|---|---|
| PubChem CID | 11238486 |
| Molecular Formula | C25H32O15 |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | methyl (1S,4aS,8aS)-1-methyl-3-oxo-8-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4,4a,8,8a-tetrahydro-1H-pyrano[3,4-c]pyran-5-carboxylate |
| SMILES | COC(=O)C1=COC(O[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@@H]2[C@H](C)OC(=O)C[C@H]12 |
| InChI | InChI=1S/C25H32O15/c1-10-19-15(7-18(30)35-10)16(23(31)32-6)8-34-24(19)40-25-22(38-14(5)29)21(37-13(4)28)20(36-12(3)27)17(39-25)9-33-11(2)26/h8,10,15,17,19-22,24-25H,7,9H2,1-6H3/t10-,15+,17+,19+,20+,21-,22+,24?,25-/m0/s1 |
| InChIKey | UAHVKBKQLXMVPS-VAEWPYPBSA-N |
| XLogP | 0.07 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|